Số nguyên n thỏa mãn: C5n-2+C5n-1+C5n+P4-n=(4-n)!+25 là

A.

4.

B.

3.

C.

5.

D.

2.

Đáp án và lời giải
Đáp án:B
Lời giải:

+ Cách 1: Thay từng đáp án vào phương trình để kiểm tra thấy n=3 thỏa mãn.

+ Cách 2: Giải phương trình

 C5n-21+1n-1+1nn-1=25nn-1+n+1nn-1.C5n-2=25n2+1n2-n.5!n-2!7-n!=25n=3.

Bạn có muốn?

Xem thêm các đề thi trắc nghiệm khác

Chia sẻ

Một số câu hỏi khác có thể bạn quan tâm.

Loading...